C22H20N6O3S2 — CID 46628074
(E)-1-[4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazin-1-yl]-3-(1-phenylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 46628074) has the molecular formula C22H20N6O3S2 and a molecular weight of 480.58 g/mol. Its IUPAC name is (E)-1-[4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazin-1-yl]-3-(1-phenylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazin-1-yl]-3-(1-phenylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 46628074 |
| Molecular Formula | C22H20N6O3S2 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | (E)-1-[4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazin-1-yl]-3-(1-phenylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cnn(-c2ccccc2)c1)N1CCN(S(=O)(=O)c2cccc3nsnc23)CC1 |
| InChI | InChI=1S/C22H20N6O3S2/c29-21(10-9-17-15-23-28(16-17)18-5-2-1-3-6-18)26-11-13-27(14-12-26)33(30,31)20-8-4-7-19-22(20)25-32-24-19/h1-10,15-16H,11-14H2/b10-9+ |
| InChIKey | JJANZQPSHBUKPK-MDZDMXLPSA-N |
| XLogP | 2.42 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|