C18H22N4O — CID 78817934
(E)-1-(4-methyl-1,4-diazepan-1-yl)-3-(1-phenylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 78817934) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is (E)-1-(4-methyl-1,4-diazepan-1-yl)-3-(1-phenylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-methyl-1,4-diazepan-1-yl)-3-(1-phenylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 78817934 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (E)-1-(4-methyl-1,4-diazepan-1-yl)-3-(1-phenylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | CN1CCCN(C(=O)/C=C/c2cnn(-c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C18H22N4O/c1-20-10-5-11-21(13-12-20)18(23)9-8-16-14-19-22(15-16)17-6-3-2-4-7-17/h2-4,6-9,14-15H,5,10-13H2,1H3/b9-8+ |
| InChIKey | PCWQWHMCAMHFNV-CMDGGOBGSA-N |
| XLogP | 2.05 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|