C24H26N4OS — CID 46479951
(E)-3-(1-phenylpyrazol-4-yl)-1-[4-(2-phenylsulfanylethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 46479951) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is (E)-3-(1-phenylpyrazol-4-yl)-1-[4-(2-phenylsulfanylethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1-phenylpyrazol-4-yl)-1-[4-(2-phenylsulfanylethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46479951 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (E)-3-(1-phenylpyrazol-4-yl)-1-[4-(2-phenylsulfanylethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cnn(-c2ccccc2)c1)N1CCN(CCSc2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N4OS/c29-24(12-11-21-19-25-28(20-21)22-7-3-1-4-8-22)27-15-13-26(14-16-27)17-18-30-23-9-5-2-6-10-23/h1-12,19-20H,13-18H2/b12-11+ |
| InChIKey | XVLFVHZZDSCKSA-VAWYXSNFSA-N |
| XLogP | 3.82 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|