C19H28N2O — CID 17164887
(E)-3-(4-tert-butylphenyl)-1-(4-methyl-1,4-diazepan-1-yl)prop-2-en-1-one (PubChem CID 17164887) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-1-(4-methyl-1,4-diazepan-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-tert-butylphenyl)-1-(4-methyl-1,4-diazepan-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 17164887 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-1-(4-methyl-1,4-diazepan-1-yl)prop-2-en-1-one |
| SMILES | CN1CCCN(C(=O)/C=C/c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H28N2O/c1-19(2,3)17-9-6-16(7-10-17)8-11-18(22)21-13-5-12-20(4)14-15-21/h6-11H,5,12-15H2,1-4H3/b11-8+ |
| InChIKey | SMDYXTPKEVXOBT-DHZHZOJOSA-N |
| XLogP | 3.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|