C19H21F3N2O5 — CID 67083971
(E)-3-[4-[(E)-3-(4-methylpiperazin-1-yl)-3-oxoprop-1-enyl]phenyl]prop-2-enoic acid;2,2,2-trifluoroacetic acid (PubChem CID 67083971) has the molecular formula C19H21F3N2O5 and a molecular weight of 414.38 g/mol. Its IUPAC name is (E)-3-[4-[(E)-3-(4-methylpiperazin-1-yl)-3-oxoprop-1-enyl]phenyl]prop-2-enoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (E)-3-[4-[(E)-3-(4-methylpiperazin-1-yl)-3-oxoprop-1-enyl]phenyl]prop-2-enoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67083971 |
| Molecular Formula | C19H21F3N2O5 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (E)-3-[4-[(E)-3-(4-methylpiperazin-1-yl)-3-oxoprop-1-enyl]phenyl]prop-2-enoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCN(C(=O)/C=C/c2ccc(/C=C/C(=O)O)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H20N2O3.C2HF3O2/c1-18-10-12-19(13-11-18)16(20)8-6-14-2-4-15(5-3-14)7-9-17(21)22;3-2(4,5)1(6)7/h2-9H,10-13H2,1H3,(H,21,22);(H,6,7)/b8-6+,9-7+; |
| InChIKey | IEEBHMQRSCYOIG-SLGVWIAZSA-N |
| XLogP | 2.20 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|