C18H17N5O5S2 — CID 43010676
1-[4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazin-1-yl]-2-(4-nitrophenyl)ethanone (PubChem CID 43010676) has the molecular formula C18H17N5O5S2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 1-[4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazin-1-yl]-2-(4-nitrophenyl)ethanone.
| Compound Name | 1-[4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazin-1-yl]-2-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 43010676 |
| Molecular Formula | C18H17N5O5S2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 1-[4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazin-1-yl]-2-(4-nitrophenyl)ethanone |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)N1CCN(S(=O)(=O)c2cccc3nsnc23)CC1 |
| InChI | InChI=1S/C18H17N5O5S2/c24-17(12-13-4-6-14(7-5-13)23(25)26)21-8-10-22(11-9-21)30(27,28)16-3-1-2-15-18(16)20-29-19-15/h1-7H,8-12H2 |
| InChIKey | OYVMYERIYQQTCD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 126.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|