C14H18N4O3S2 — CID 3240464
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-cyclohexylacetamide (PubChem CID 3240464) has the molecular formula C14H18N4O3S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-cyclohexylacetamide.
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 3240464 |
| Molecular Formula | C14H18N4O3S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-cyclohexylacetamide |
| SMILES | O=C(CNS(=O)(=O)c1cccc2nsnc12)NC1CCCCC1 |
| InChI | InChI=1S/C14H18N4O3S2/c19-13(16-10-5-2-1-3-6-10)9-15-23(20,21)12-8-4-7-11-14(12)18-22-17-11/h4,7-8,10,15H,1-3,5-6,9H2,(H,16,19) |
| InChIKey | BUEROIAOYVUBTJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |