C14H17N3O3S2 — CID 71892250
N-(2,1,3-benzothiadiazol-4-ylsulfonyl)-2-cyclohexylacetamide (PubChem CID 71892250) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-ylsulfonyl)-2-cyclohexylacetamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-ylsulfonyl)-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 71892250 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-ylsulfonyl)-2-cyclohexylacetamide |
| SMILES | O=C(CC1CCCCC1)NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C14H17N3O3S2/c18-13(9-10-5-2-1-3-6-10)17-22(19,20)12-8-4-7-11-14(12)16-21-15-11/h4,7-8,10H,1-3,5-6,9H2,(H,17,18) |
| InChIKey | ZUHSWNPBTGWJJJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |