C11H13N3O3S2 — CID 2906606
N-(oxolan-2-ylmethyl)-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 2906606) has the molecular formula C11H13N3O3S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 2906606 |
| Molecular Formula | C11H13N3O3S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | O=S(=O)(NCC1CCCO1)c1cccc2nsnc12 |
| InChI | InChI=1S/C11H13N3O3S2/c15-19(16,12-7-8-3-2-6-17-8)10-5-1-4-9-11(10)14-18-13-9/h1,4-5,8,12H,2-3,6-7H2 |
| InChIKey | QNCQJOMNJVFJEL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |