C19H20N4O3S2 — CID 3245959
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-cyclopentyl-2-phenylacetamide (PubChem CID 3245959) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-cyclopentyl-2-phenylacetamide.
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-cyclopentyl-2-phenylacetamide |
|---|---|
| PubChem CID | 3245959 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-cyclopentyl-2-phenylacetamide |
| SMILES | O=C(NC1CCCC1)C(NS(=O)(=O)c1cccc2nsnc12)c1ccccc1 |
| InChI | InChI=1S/C19H20N4O3S2/c24-19(20-14-9-4-5-10-14)17(13-7-2-1-3-8-13)23-28(25,26)16-12-6-11-15-18(16)22-27-21-15/h1-3,6-8,11-12,14,17,23H,4-5,9-10H2,(H,20,24) |
| InChIKey | VBSHFCSMXKLJAB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |