C16H15N3O4S2 — CID 2399113
benzyl (2R)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate (PubChem CID 2399113) has the molecular formula C16H15N3O4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is benzyl (2R)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate.
| Compound Name | benzyl (2R)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 2399113 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | benzyl (2R)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate |
| SMILES | C[C@@H](NS(=O)(=O)c1cccc2nsnc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H15N3O4S2/c1-11(16(20)23-10-12-6-3-2-4-7-12)19-25(21,22)14-9-5-8-13-15(14)18-24-17-13/h2-9,11,19H,10H2,1H3/t11-/m1/s1 |
| InChIKey | XMJRSMPSRJVCHF-LLVKDONJSA-N |
| XLogP | 2.10 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |