C20H16N6O5S2 — CID 2433379
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (2S)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate (PubChem CID 2433379) has the molecular formula C20H16N6O5S2 and a molecular weight of 484.52 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (2S)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (2S)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 2433379 |
| Molecular Formula | C20H16N6O5S2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (2S)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate |
| SMILES | C[C@H](NS(=O)(=O)c1cccc2nsnc12)C(=O)OCC(O)=C(C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H16N6O5S2/c1-11(26-33(29,30)17-8-4-7-15-18(17)25-32-24-15)20(28)31-10-16(27)12(9-21)19-22-13-5-2-3-6-14(13)23-19/h2-8,11,26-27H,10H2,1H3,(H,22,23)/t11-/m0/s1 |
| InChIKey | XPLHUUJRTWEBEA-NSHDSACASA-N |
| XLogP | 2.27 |
| TPSA | 170.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|