About (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate
(4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate (PubChem CID 25046089) has the molecular formula C19H18N4O4S2
and a molecular weight of 430.51 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate |
| PubChem CID | 25046089 |
| Molecular Formula | C19H18N4O4S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate |
| SMILES | CC(C)C(NS(=O)(=O)c1cccc2nsnc12)C(=O)OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H18N4O4S2/c1-12(2)17(19(24)27-11-14-8-6-13(10-20)7-9-14)23-29(25,26)16-5-3-4-15-18(16)22-28-21-15/h3-9,12,17,23H,11H2,1-2H3 |
| InChIKey | OVNFJLIOCDVBDB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate?
The IUPAC name of (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate (CID 25046089) is (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate.
What is the SMILES notation for (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate?
The canonical SMILES for (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate is CC(C)C(NS(=O)(=O)c1cccc2nsnc12)C(=O)OCc1ccc(C#N)cc1.
What is the InChIKey of (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate?
The InChIKey is OVNFJLIOCDVBDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O4S2/c1-12(2)17(19(24)27-11-14-8-6-13(10-20)7-9-14)23-29(25,26)16-5-3-4-15-18(16)22-28-21-15/h3-9,12,17,23H,11H2,1-2H3.
What are the key properties of (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate?
(4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate has a molecular weight of 430.51 g/mol, XLogP of 2.61, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-methylbutanoate is sourced from PubChem (CID 25046089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).