About (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate
(3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate (PubChem CID 25039475) has the molecular formula C16H14ClN3O4S2
and a molecular weight of 411.89 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate.
Molecular Properties
| Compound Name | (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate |
| PubChem CID | 25039475 |
| Molecular Formula | C16H14ClN3O4S2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate |
| SMILES | CC(NS(=O)(=O)c1cccc2nsnc12)C(=O)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClN3O4S2/c1-10(16(21)24-9-11-4-2-5-12(17)8-11)20-26(22,23)14-7-3-6-13-15(14)19-25-18-13/h2-8,10,20H,9H2,1H3 |
| InChIKey | VTTTVSFPHNGJHE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate?
The IUPAC name of (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate (CID 25039475) is (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate.
What is the SMILES notation for (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate?
The canonical SMILES for (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate is CC(NS(=O)(=O)c1cccc2nsnc12)C(=O)OCc1cccc(Cl)c1.
What is the InChIKey of (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate?
The InChIKey is VTTTVSFPHNGJHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3O4S2/c1-10(16(21)24-9-11-4-2-5-12(17)8-11)20-26(22,23)14-7-3-6-13-15(14)19-25-18-13/h2-8,10,20H,9H2,1H3.
What are the key properties of (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate?
(3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate has a molecular weight of 411.89 g/mol, XLogP of 2.75, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoate is sourced from PubChem (CID 25039475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).