C12H14N3O4S2- — CID 2342094
(2S)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3,3-dimethylbutanoate (PubChem CID 2342094) has the molecular formula C12H14N3O4S2- and a molecular weight of 328.40 g/mol. Its IUPAC name is (2S)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3,3-dimethylbutanoate.
| Compound Name | (2S)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 2342094 |
| Molecular Formula | C12H14N3O4S2- |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | (2S)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)[C@H](NS(=O)(=O)c1cccc2nsnc12)C(=O)[O-] |
| InChI | InChI=1S/C12H15N3O4S2/c1-12(2,3)10(11(16)17)15-21(18,19)8-6-4-5-7-9(8)14-20-13-7/h4-6,10,15H,1-3H3,(H,16,17)/p-1/t10-/m1/s1 |
| InChIKey | SQDJLLIDJLQWJF-SNVBAGLBSA-M |
| XLogP | 0.13 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |