C14H11N3O4S2 — CID 585289
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-phenylacetic acid (PubChem CID 585289) has the molecular formula C14H11N3O4S2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-phenylacetic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-phenylacetic acid |
|---|---|
| PubChem CID | 585289 |
| Molecular Formula | C14H11N3O4S2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-phenylacetic acid |
| SMILES | O=C(O)C(NS(=O)(=O)c1cccc2nsnc12)c1ccccc1 |
| InChI | InChI=1S/C14H11N3O4S2/c18-14(19)12(9-5-2-1-3-6-9)17-23(20,21)11-8-4-7-10-13(11)16-22-15-10/h1-8,12,17H,(H,18,19) |
| InChIKey | DIKJBLCQBZUCRC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |