C26H23N5O5S2 — CID 20857010
N-[2-[3,5-dioxo-4-(2-phenylethyl)piperazin-1-yl]-2-oxo-1-phenylethyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 20857010) has the molecular formula C26H23N5O5S2 and a molecular weight of 549.63 g/mol. Its IUPAC name is N-[2-[3,5-dioxo-4-(2-phenylethyl)piperazin-1-yl]-2-oxo-1-phenylethyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[2-[3,5-dioxo-4-(2-phenylethyl)piperazin-1-yl]-2-oxo-1-phenylethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 20857010 |
| Molecular Formula | C26H23N5O5S2 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | N-[2-[3,5-dioxo-4-(2-phenylethyl)piperazin-1-yl]-2-oxo-1-phenylethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | O=C(C(NS(=O)(=O)c1cccc2nsnc12)c1ccccc1)N1CC(=O)N(CCc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C26H23N5O5S2/c32-22-16-30(17-23(33)31(22)15-14-18-8-3-1-4-9-18)26(34)24(19-10-5-2-6-11-19)29-38(35,36)21-13-7-12-20-25(21)28-37-27-20/h1-13,24,29H,14-17H2 |
| InChIKey | WKBKRANXJRJGTM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|