C22H26N4O3S2 — CID 93157893
(2R)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-phenylacetamide (PubChem CID 93157893) has the molecular formula C22H26N4O3S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is (2R)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-phenylacetamide.
| Compound Name | (2R)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 93157893 |
| Molecular Formula | C22H26N4O3S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (2R)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-phenylacetamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@H](NS(=O)(=O)c1cccc2nsnc12)c1ccccc1 |
| InChI | InChI=1S/C22H26N4O3S2/c1-14-8-6-11-17(15(14)2)23-22(27)20(16-9-4-3-5-10-16)26-31(28,29)19-13-7-12-18-21(19)25-30-24-18/h3-5,7,9-10,12-15,17,20,26H,6,8,11H2,1-2H3,(H,23,27)/t14-,15-,17+,20-/m1/s1 |
| InChIKey | VIRHPVOBUQAHCO-RNKNFESXSA-N |
| XLogP | 3.65 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |