C22H32N4O3S2 — CID 129425090
4-[(2,1,3-benzothiadiazol-4-ylsulfonylamino)methyl]-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]cyclohexane-1-carboxamide (PubChem CID 129425090) has the molecular formula C22H32N4O3S2 and a molecular weight of 464.66 g/mol. Its IUPAC name is 4-[(2,1,3-benzothiadiazol-4-ylsulfonylamino)methyl]-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]cyclohexane-1-carboxamide.
| Compound Name | 4-[(2,1,3-benzothiadiazol-4-ylsulfonylamino)methyl]-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 129425090 |
| Molecular Formula | C22H32N4O3S2 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 4-[(2,1,3-benzothiadiazol-4-ylsulfonylamino)methyl]-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]cyclohexane-1-carboxamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NC(=O)C1CCC(CNS(=O)(=O)c2cccc3nsnc23)CC1 |
| InChI | InChI=1S/C22H32N4O3S2/c1-14-5-3-6-18(15(14)2)24-22(27)17-11-9-16(10-12-17)13-23-31(28,29)20-8-4-7-19-21(20)26-30-25-19/h4,7-8,14-18,23H,3,5-6,9-13H2,1-2H3,(H,24,27)/t14-,15+,16?,17?,18-/m1/s1 |
| InChIKey | RMKDQMQWHFIQMY-YFVGIKETSA-N |
| XLogP | 3.72 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |