C23H32N4O3S2 — CID 20862316
4-[(2,1,3-benzothiadiazol-4-ylsulfonylamino)methyl]-N-cyclohexyl-N-prop-2-enylcyclohexane-1-carboxamide (PubChem CID 20862316) has the molecular formula C23H32N4O3S2 and a molecular weight of 476.67 g/mol. Its IUPAC name is 4-[(2,1,3-benzothiadiazol-4-ylsulfonylamino)methyl]-N-cyclohexyl-N-prop-2-enylcyclohexane-1-carboxamide.
| Compound Name | 4-[(2,1,3-benzothiadiazol-4-ylsulfonylamino)methyl]-N-cyclohexyl-N-prop-2-enylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 20862316 |
| Molecular Formula | C23H32N4O3S2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 4-[(2,1,3-benzothiadiazol-4-ylsulfonylamino)methyl]-N-cyclohexyl-N-prop-2-enylcyclohexane-1-carboxamide |
| SMILES | C=CCN(C(=O)C1CCC(CNS(=O)(=O)c2cccc3nsnc23)CC1)C1CCCCC1 |
| InChI | InChI=1S/C23H32N4O3S2/c1-2-15-27(19-7-4-3-5-8-19)23(28)18-13-11-17(12-14-18)16-24-32(29,30)21-10-6-9-20-22(21)26-31-25-20/h2,6,9-10,17-19,24H,1,3-5,7-8,11-16H2 |
| InChIKey | DKCNNSDWZRMQNE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|