C16H21F2N3O6S — CID 51956527
(3S)-N-[2-(difluoromethoxy)-5-nitrophenyl]-1-propylsulfonylpiperidine-3-carboxamide (PubChem CID 51956527) has the molecular formula C16H21F2N3O6S and a molecular weight of 421.42 g/mol. Its IUPAC name is (3S)-N-[2-(difluoromethoxy)-5-nitrophenyl]-1-propylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(difluoromethoxy)-5-nitrophenyl]-1-propylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 51956527 |
| Molecular Formula | C16H21F2N3O6S |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (3S)-N-[2-(difluoromethoxy)-5-nitrophenyl]-1-propylsulfonylpiperidine-3-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCC[C@H](C(=O)Nc2cc([N+](=O)[O-])ccc2OC(F)F)C1 |
| InChI | InChI=1S/C16H21F2N3O6S/c1-2-8-28(25,26)20-7-3-4-11(10-20)15(22)19-13-9-12(21(23)24)5-6-14(13)27-16(17)18/h5-6,9,11,16H,2-4,7-8,10H2,1H3,(H,19,22)/t11-/m0/s1 |
| InChIKey | AFYTXPLJPRNZLS-NSHDSACASA-N |
| XLogP | 2.59 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|