C22H22F3N3O8S — CID 129375691
[2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] (2S,4R)-1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 129375691) has the molecular formula C22H22F3N3O8S and a molecular weight of 545.49 g/mol. Its IUPAC name is [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] (2S,4R)-1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] (2S,4R)-1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 129375691 |
| Molecular Formula | C22H22F3N3O8S |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] (2S,4R)-1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](O)C[C@H]2C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2C(F)(F)F)cc1C |
| InChI | InChI=1S/C22H22F3N3O8S/c1-12-3-5-16(7-13(12)2)37(34,35)27-10-15(29)9-19(27)21(31)36-11-20(30)26-18-6-4-14(28(32)33)8-17(18)22(23,24)25/h3-8,15,19,29H,9-11H2,1-2H3,(H,26,30)/t15-,19+/m1/s1 |
| InChIKey | XSNZEWFMBWEIDD-BEFAXECRSA-N |
| XLogP | 2.54 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|