C22H25N3O7S — CID 46517289
[2-(2-nitroanilino)-2-oxoethyl] 1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 46517289) has the molecular formula C22H25N3O7S and a molecular weight of 475.52 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 46517289 |
| Molecular Formula | C22H25N3O7S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCCC2C(=O)OCC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C22H25N3O7S/c1-14-11-15(2)21(16(3)12-14)33(30,31)24-10-6-9-19(24)22(27)32-13-20(26)23-17-7-4-5-8-18(17)25(28)29/h4-5,7-8,11-12,19H,6,9-10,13H2,1-3H3,(H,23,26) |
| InChIKey | JGOHDJUPGUMZHI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|