C15H14F3N3O4 — CID 6134901
N-(4-nitrophenyl)-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxamide (PubChem CID 6134901) has the molecular formula C15H14F3N3O4 and a molecular weight of 357.29 g/mol. Its IUPAC name is N-(4-nitrophenyl)-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(4-nitrophenyl)-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6134901 |
| Molecular Formula | C15H14F3N3O4 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-(4-nitrophenyl)-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C1CCCN1/C=C/C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H14F3N3O4/c16-15(17,18)13(22)7-9-20-8-1-2-12(20)14(23)19-10-3-5-11(6-4-10)21(24)25/h3-7,9,12H,1-2,8H2,(H,19,23)/b9-7+ |
| InChIKey | XEZWSYCFPXNRPF-VQHVLOKHSA-N |
| XLogP | 2.64 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|