C16H16BrF3N2O2 — CID 7104638
(2S)-N-(4-bromo-2-methylphenyl)-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxamide (PubChem CID 7104638) has the molecular formula C16H16BrF3N2O2 and a molecular weight of 405.21 g/mol. Its IUPAC name is (2S)-N-(4-bromo-2-methylphenyl)-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4-bromo-2-methylphenyl)-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 7104638 |
| Molecular Formula | C16H16BrF3N2O2 |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | (2S)-N-(4-bromo-2-methylphenyl)-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)[C@@H]1CCCN1/C=C/C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H16BrF3N2O2/c1-10-9-11(17)4-5-12(10)21-15(24)13-3-2-7-22(13)8-6-14(23)16(18,19)20/h4-6,8-9,13H,2-3,7H2,1H3,(H,21,24)/b8-6+/t13-/m0/s1 |
| InChIKey | MTYLHCVKAXBXES-CFNZNRNTSA-N |
| XLogP | 3.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|