C18H23NO3 — CID 2618327
[2-(2,6-diethylanilino)-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 2618327) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 2618327 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OCC(=O)Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C18H23NO3/c1-4-7-8-12-17(21)22-13-16(20)19-18-14(5-2)10-9-11-15(18)6-3/h4,7-12H,5-6,13H2,1-3H3,(H,19,20)/b7-4+,12-8+ |
| InChIKey | HALNQAZDSPGDSE-HCFISPQYSA-N |
| XLogP | 3.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|