C14H12Cl3NO3 — CID 7779222
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 7779222) has the molecular formula C14H12Cl3NO3 and a molecular weight of 348.61 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 7779222 |
| Molecular Formula | C14H12Cl3NO3 |
| Molecular Weight | 348.61 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OCC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl3NO3/c1-2-3-4-5-14(20)21-8-13(19)18-12-7-10(16)9(15)6-11(12)17/h2-7H,8H2,1H3,(H,18,19)/b3-2+,5-4+ |
| InChIKey | YBTVHFZHCSUCMM-MQQKCMAXSA-N |
| XLogP | 4.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|