C12H10Cl3NO3 — CID 7699128
[2-oxo-2-(2,4,6-trichloroanilino)ethyl] (E)-but-2-enoate (PubChem CID 7699128) has the molecular formula C12H10Cl3NO3 and a molecular weight of 322.58 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trichloroanilino)ethyl] (E)-but-2-enoate.
| Compound Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 7699128 |
| Molecular Formula | C12H10Cl3NO3 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCC(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H10Cl3NO3/c1-2-3-11(18)19-6-10(17)16-12-8(14)4-7(13)5-9(12)15/h2-5H,6H2,1H3,(H,16,17)/b3-2+ |
| InChIKey | GJBLVYNKWYTIKU-NSCUHMNNSA-N |
| XLogP | 3.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|