C15H12Cl3NO4 — CID 8861610
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2,5-dimethylfuran-3-carboxylate (PubChem CID 8861610) has the molecular formula C15H12Cl3NO4 and a molecular weight of 376.62 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2,5-dimethylfuran-3-carboxylate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2,5-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8861610 |
| Molecular Formula | C15H12Cl3NO4 |
| Molecular Weight | 376.62 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2,5-dimethylfuran-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)c(C)o1 |
| InChI | InChI=1S/C15H12Cl3NO4/c1-7-3-9(8(2)23-7)15(21)22-6-14(20)19-13-5-11(17)10(16)4-12(13)18/h3-5H,6H2,1-2H3,(H,19,20) |
| InChIKey | XRONYQHUSMIIPA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|