C21H23NO8 — CID 2584527
diethyl 5-[[2-(2,5-dimethylfuran-3-carbonyl)oxyacetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 2584527) has the molecular formula C21H23NO8 and a molecular weight of 417.41 g/mol. Its IUPAC name is diethyl 5-[[2-(2,5-dimethylfuran-3-carbonyl)oxyacetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[[2-(2,5-dimethylfuran-3-carbonyl)oxyacetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2584527 |
| Molecular Formula | C21H23NO8 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | diethyl 5-[[2-(2,5-dimethylfuran-3-carbonyl)oxyacetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)COC(=O)c2cc(C)oc2C)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C21H23NO8/c1-5-27-19(24)14-8-15(20(25)28-6-2)10-16(9-14)22-18(23)11-29-21(26)17-7-12(3)30-13(17)4/h7-10H,5-6,11H2,1-4H3,(H,22,23) |
| InChIKey | PTPCNWWFFWJHMB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|