C16H16N2O5 — CID 7844551
[2-(2-carbamoylanilino)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate (PubChem CID 7844551) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is [2-(2-carbamoylanilino)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate.
| Compound Name | [2-(2-carbamoylanilino)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 7844551 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [2-(2-carbamoylanilino)-2-oxoethyl] 2,5-dimethylfuran-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)Nc2ccccc2C(N)=O)c(C)o1 |
| InChI | InChI=1S/C16H16N2O5/c1-9-7-12(10(2)23-9)16(21)22-8-14(19)18-13-6-4-3-5-11(13)15(17)20/h3-7H,8H2,1-2H3,(H2,17,20)(H,18,19) |
| InChIKey | LNSKUFOCJRBAFA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |