C20H20N2O4S2 — CID 40618126
1,3-benzothiazol-2-ylmethyl (2R)-1-(benzenesulfonyl)piperidine-2-carboxylate (PubChem CID 40618126) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl (2R)-1-(benzenesulfonyl)piperidine-2-carboxylate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl (2R)-1-(benzenesulfonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 40618126 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl (2R)-1-(benzenesulfonyl)piperidine-2-carboxylate |
| SMILES | O=C(OCc1nc2ccccc2s1)[C@H]1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O4S2/c23-20(26-14-19-21-16-10-4-5-12-18(16)27-19)17-11-6-7-13-22(17)28(24,25)15-8-2-1-3-9-15/h1-5,8-10,12,17H,6-7,11,13-14H2/t17-/m1/s1 |
| InChIKey | AXWCNYLYGJZPMA-QGZVFWFLSA-N |
| XLogP | 3.58 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |