C22H21ClN2O4S — CID 43026030
(2-chloroquinolin-3-yl)methyl 1-(benzenesulfonyl)piperidine-2-carboxylate (PubChem CID 43026030) has the molecular formula C22H21ClN2O4S and a molecular weight of 444.94 g/mol. Its IUPAC name is (2-chloroquinolin-3-yl)methyl 1-(benzenesulfonyl)piperidine-2-carboxylate.
| Compound Name | (2-chloroquinolin-3-yl)methyl 1-(benzenesulfonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 43026030 |
| Molecular Formula | C22H21ClN2O4S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | (2-chloroquinolin-3-yl)methyl 1-(benzenesulfonyl)piperidine-2-carboxylate |
| SMILES | O=C(OCc1cc2ccccc2nc1Cl)C1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H21ClN2O4S/c23-21-17(14-16-8-4-5-11-19(16)24-21)15-29-22(26)20-12-6-7-13-25(20)30(27,28)18-9-2-1-3-10-18/h1-5,8-11,14,20H,6-7,12-13,15H2 |
| InChIKey | IQIHCWRJXXYCEI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|