C20H19ClN4O2 — CID 55701547
(2-chloroquinolin-3-yl)methyl 1-pyrimidin-2-ylpiperidine-4-carboxylate (PubChem CID 55701547) has the molecular formula C20H19ClN4O2 and a molecular weight of 382.85 g/mol. Its IUPAC name is (2-chloroquinolin-3-yl)methyl 1-pyrimidin-2-ylpiperidine-4-carboxylate.
| Compound Name | (2-chloroquinolin-3-yl)methyl 1-pyrimidin-2-ylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55701547 |
| Molecular Formula | C20H19ClN4O2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (2-chloroquinolin-3-yl)methyl 1-pyrimidin-2-ylpiperidine-4-carboxylate |
| SMILES | O=C(OCc1cc2ccccc2nc1Cl)C1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H19ClN4O2/c21-18-16(12-15-4-1-2-5-17(15)24-18)13-27-19(26)14-6-10-25(11-7-14)20-22-8-3-9-23-20/h1-5,8-9,12,14H,6-7,10-11,13H2 |
| InChIKey | IPVOWCANWXDOAG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|