C13H17N3O2 — CID 86826366
prop-2-enyl 1-pyrimidin-2-ylpiperidine-4-carboxylate (PubChem CID 86826366) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is prop-2-enyl 1-pyrimidin-2-ylpiperidine-4-carboxylate.
| Compound Name | prop-2-enyl 1-pyrimidin-2-ylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 86826366 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | prop-2-enyl 1-pyrimidin-2-ylpiperidine-4-carboxylate |
| SMILES | C=CCOC(=O)C1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C13H17N3O2/c1-2-10-18-12(17)11-4-8-16(9-5-11)13-14-6-3-7-15-13/h2-3,6-7,11H,1,4-5,8-10H2 |
| InChIKey | KGVKJEKXSITSCQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|