C21H26N4O4 — CID 55999654
[2-[1-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-4-carboxylate (PubChem CID 55999654) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-[1-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-4-carboxylate.
| Compound Name | [2-[1-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55999654 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | [2-[1-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-4-carboxylate |
| SMILES | COc1ccccc1C(C)NC(=O)COC(=O)C1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H26N4O4/c1-15(17-6-3-4-7-18(17)28-2)24-19(26)14-29-20(27)16-8-12-25(13-9-16)21-22-10-5-11-23-21/h3-7,10-11,15-16H,8-9,12-14H2,1-2H3,(H,24,26) |
| InChIKey | XTXJAOKVMKGNNP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |