C25H26N4O4 — CID 55998309
[2-[2-(4-methylphenoxy)anilino]-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-4-carboxylate (PubChem CID 55998309) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is [2-[2-(4-methylphenoxy)anilino]-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-4-carboxylate.
| Compound Name | [2-[2-(4-methylphenoxy)anilino]-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55998309 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | [2-[2-(4-methylphenoxy)anilino]-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-4-carboxylate |
| SMILES | Cc1ccc(Oc2ccccc2NC(=O)COC(=O)C2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C25H26N4O4/c1-18-7-9-20(10-8-18)33-22-6-3-2-5-21(22)28-23(30)17-32-24(31)19-11-15-29(16-12-19)25-26-13-4-14-27-25/h2-10,13-14,19H,11-12,15-17H2,1H3,(H,28,30) |
| InChIKey | KXXCQKMDIIBART-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |