C18H22N4O3 — CID 3223156
N-(2,6-dimethoxyphenyl)-1-pyrimidin-2-ylpiperidine-4-carboxamide (PubChem CID 3223156) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(2,6-dimethoxyphenyl)-1-pyrimidin-2-ylpiperidine-4-carboxamide.
| Compound Name | N-(2,6-dimethoxyphenyl)-1-pyrimidin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3223156 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-(2,6-dimethoxyphenyl)-1-pyrimidin-2-ylpiperidine-4-carboxamide |
| SMILES | COc1cccc(OC)c1NC(=O)C1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H22N4O3/c1-24-14-5-3-6-15(25-2)16(14)21-17(23)13-7-11-22(12-8-13)18-19-9-4-10-20-18/h3-6,9-10,13H,7-8,11-12H2,1-2H3,(H,21,23) |
| InChIKey | WFLLTACKPCEGQH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |