C19H21N3O2 — CID 35456039
[(E)-3-phenylprop-2-enyl] (3S)-1-pyrimidin-2-ylpiperidine-3-carboxylate (PubChem CID 35456039) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] (3S)-1-pyrimidin-2-ylpiperidine-3-carboxylate.
| Compound Name | [(E)-3-phenylprop-2-enyl] (3S)-1-pyrimidin-2-ylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 35456039 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] (3S)-1-pyrimidin-2-ylpiperidine-3-carboxylate |
| SMILES | O=C(OC/C=C/c1ccccc1)[C@H]1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C19H21N3O2/c23-18(24-14-5-9-16-7-2-1-3-8-16)17-10-4-13-22(15-17)19-20-11-6-12-21-19/h1-3,5-9,11-12,17H,4,10,13-15H2/b9-5+/t17-/m0/s1 |
| InChIKey | GPPXDAMMQDDUHB-MPNRVQBSSA-N |
| XLogP | 2.95 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |