C23H29N5O5S — CID 55998185
[2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-4-carboxylate (PubChem CID 55998185) has the molecular formula C23H29N5O5S and a molecular weight of 487.58 g/mol. Its IUPAC name is [2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-4-carboxylate.
| Compound Name | [2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55998185 |
| Molecular Formula | C23H29N5O5S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | [2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethyl] 1-pyrimidin-2-ylpiperidine-4-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(S(=O)(=O)Cc2ccccc2)CC1)C1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C23H29N5O5S/c29-21(17-33-22(30)20-7-11-27(12-8-20)23-24-9-4-10-25-23)26-13-15-28(16-14-26)34(31,32)18-19-5-2-1-3-6-19/h1-6,9-10,20H,7-8,11-18H2 |
| InChIKey | LMHVMODQBSYMDI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 113.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |