C18H24N4O3 — CID 51111006
[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl] bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 51111006) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl] bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl] bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 51111006 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | [2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl] bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(c2ncccn2)CC1)C1CC2CCC1C2 |
| InChI | InChI=1S/C18H24N4O3/c23-16(12-25-17(24)15-11-13-2-3-14(15)10-13)21-6-8-22(9-7-21)18-19-4-1-5-20-18/h1,4-5,13-15H,2-3,6-12H2 |
| InChIKey | RRLWXYIEHSRYFB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |