C20H26N4O5S — CID 55998172
2-[4-(dimethylsulfamoyl)phenoxy]ethyl 1-pyrimidin-2-ylpiperidine-4-carboxylate (PubChem CID 55998172) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 1-pyrimidin-2-ylpiperidine-4-carboxylate.
| Compound Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 1-pyrimidin-2-ylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55998172 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 1-pyrimidin-2-ylpiperidine-4-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCOC(=O)C2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C20H26N4O5S/c1-23(2)30(26,27)18-6-4-17(5-7-18)28-14-15-29-19(25)16-8-12-24(13-9-16)20-21-10-3-11-22-20/h3-7,10-11,16H,8-9,12-15H2,1-2H3 |
| InChIKey | YJNBAHOHJHLWIL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|