C22H27N3O7S — CID 31803031
2-[4-(dimethylsulfamoyl)phenoxy]ethyl 1-(2-nitrophenyl)piperidine-4-carboxylate (PubChem CID 31803031) has the molecular formula C22H27N3O7S and a molecular weight of 477.54 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 1-(2-nitrophenyl)piperidine-4-carboxylate.
| Compound Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 1-(2-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 31803031 |
| Molecular Formula | C22H27N3O7S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 1-(2-nitrophenyl)piperidine-4-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCOC(=O)C2CCN(c3ccccc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C22H27N3O7S/c1-23(2)33(29,30)19-9-7-18(8-10-19)31-15-16-32-22(26)17-11-13-24(14-12-17)20-5-3-4-6-21(20)25(27)28/h3-10,17H,11-16H2,1-2H3 |
| InChIKey | JTGZTYYVSYNWAX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|