C20H20F2N2O5 — CID 55975173
[4-(difluoromethoxy)phenyl]methyl 1-(2-nitrophenyl)piperidine-4-carboxylate (PubChem CID 55975173) has the molecular formula C20H20F2N2O5 and a molecular weight of 406.39 g/mol. Its IUPAC name is [4-(difluoromethoxy)phenyl]methyl 1-(2-nitrophenyl)piperidine-4-carboxylate.
| Compound Name | [4-(difluoromethoxy)phenyl]methyl 1-(2-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55975173 |
| Molecular Formula | C20H20F2N2O5 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [4-(difluoromethoxy)phenyl]methyl 1-(2-nitrophenyl)piperidine-4-carboxylate |
| SMILES | O=C(OCc1ccc(OC(F)F)cc1)C1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H20F2N2O5/c21-20(22)29-16-7-5-14(6-8-16)13-28-19(25)15-9-11-23(12-10-15)17-3-1-2-4-18(17)24(26)27/h1-8,15,20H,9-13H2 |
| InChIKey | OUZPZUHBDJMSTM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|