C23H24N4O7 — CID 55391400
[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 1-(2-nitrophenyl)piperidine-4-carboxylate (PubChem CID 55391400) has the molecular formula C23H24N4O7 and a molecular weight of 468.47 g/mol. Its IUPAC name is [3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 1-(2-nitrophenyl)piperidine-4-carboxylate.
| Compound Name | [3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 1-(2-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55391400 |
| Molecular Formula | C23H24N4O7 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | [3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 1-(2-nitrophenyl)piperidine-4-carboxylate |
| SMILES | COc1ccc(-c2noc(COC(=O)C3CCN(c4ccccc4[N+](=O)[O-])CC3)n2)c(OC)c1 |
| InChI | InChI=1S/C23H24N4O7/c1-31-16-7-8-17(20(13-16)32-2)22-24-21(34-25-22)14-33-23(28)15-9-11-26(12-10-15)18-5-3-4-6-19(18)27(29)30/h3-8,13,15H,9-12,14H2,1-2H3 |
| InChIKey | HQCDGFCPSJGCQA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 130.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|