C16H25ClN2O5S — CID 119906798
1-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 119906798) has the molecular formula C16H25ClN2O5S and a molecular weight of 392.91 g/mol. Its IUPAC name is 1-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119906798 |
| Molecular Formula | C16H25ClN2O5S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 1-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCN2CCC(C(=O)O)CC2)cc1.Cl |
| InChI | InChI=1S/C16H24N2O5S.ClH/c1-17(2)24(21,22)15-5-3-14(4-6-15)23-12-11-18-9-7-13(8-10-18)16(19)20;/h3-6,13H,7-12H2,1-2H3,(H,19,20);1H |
| InChIKey | QKFZAOUBMDDBFT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |