C21H36N4O5S2 — CID 55626277
N-cyclohexyl-4-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-N-methylpiperazine-1-sulfonamide (PubChem CID 55626277) has the molecular formula C21H36N4O5S2 and a molecular weight of 488.68 g/mol. Its IUPAC name is N-cyclohexyl-4-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-N-methylpiperazine-1-sulfonamide.
| Compound Name | N-cyclohexyl-4-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-N-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55626277 |
| Molecular Formula | C21H36N4O5S2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | N-cyclohexyl-4-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-N-methylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCN2CCN(S(=O)(=O)N(C)C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C21H36N4O5S2/c1-22(2)31(26,27)21-11-9-20(10-12-21)30-18-17-24-13-15-25(16-14-24)32(28,29)23(3)19-7-5-4-6-8-19/h9-12,19H,4-8,13-18H2,1-3H3 |
| InChIKey | OSYPOSXZNQHHQD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |