C20H25ClN4O5S — CID 38518687
4-[2-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]ethoxy]-N,N-dimethylbenzenesulfonamide (PubChem CID 38518687) has the molecular formula C20H25ClN4O5S and a molecular weight of 468.96 g/mol. Its IUPAC name is 4-[2-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]ethoxy]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]ethoxy]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 38518687 |
| Molecular Formula | C20H25ClN4O5S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 4-[2-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]ethoxy]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCN2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C20H25ClN4O5S/c1-22(2)31(28,29)18-6-4-17(5-7-18)30-14-13-23-9-11-24(12-10-23)19-8-3-16(21)15-20(19)25(26)27/h3-8,15H,9-14H2,1-2H3 |
| InChIKey | FTWRSJZTLRCTFI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|