C18H29N3O3S — CID 55565914
N-cyclohexyl-4-(4-methoxyphenyl)-N-methylpiperazine-1-sulfonamide (PubChem CID 55565914) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is N-cyclohexyl-4-(4-methoxyphenyl)-N-methylpiperazine-1-sulfonamide.
| Compound Name | N-cyclohexyl-4-(4-methoxyphenyl)-N-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55565914 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-cyclohexyl-4-(4-methoxyphenyl)-N-methylpiperazine-1-sulfonamide |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)N(C)C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C18H29N3O3S/c1-19(16-6-4-3-5-7-16)25(22,23)21-14-12-20(13-15-21)17-8-10-18(24-2)11-9-17/h8-11,16H,3-7,12-15H2,1-2H3 |
| InChIKey | IWWBFBUTCSODGO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|