C22H35N3O2 — CID 78792835
N-cyclohexyl-N-methyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]propanamide (PubChem CID 78792835) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]propanamide.
| Compound Name | N-cyclohexyl-N-methyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 78792835 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | N-cyclohexyl-N-methyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)N(C)C1CCCCC1)N1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C22H35N3O2/c1-19(22(26)23(2)20-9-5-3-6-10-20)25-15-13-24(14-16-25)17-18-27-21-11-7-4-8-12-21/h4,7-8,11-12,19-20H,3,5-6,9-10,13-18H2,1-2H3 |
| InChIKey | BTLBYPALOALNML-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |